| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Products Intro: |
Product Name:Deoxydehydrochorismic acid
CAS:16929-37-6
Purity:>95% by HPLC Remarks:Reach out to us for more information about custom solutions.
|
| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:3-[(1-Carboxyvinyl)oxy]benzoic acid
CAS:16929-37-6
Purity:95% Package:1mg Remarks:S54597
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:Deoxydehydrochorismic acid >=95% (LC/MS-UV)
CAS:16929-37-6
Purity:NULL Package:1ea;1mg Remarks:NULL
|
|
| | 3-[(1-Carboxyvinyl)oxy]benzoic acid Basic information |
| Product Name: | 3-[(1-Carboxyvinyl)oxy]benzoic acid | | Synonyms: | 3-[(1-Carboxyethenyl)oxy]benzoic acid;3-[(1-Carboxyvinyl)oxy]benzoic acid;Benzoic acid, 3-[(1-carboxyethenyl)oxy]-;Deoxydehydrochorismic acid >=95% (LC/MS-UV);Deoxydehydrochorismic acid | | CAS: | 16929-37-6 | | MF: | C10H8O5 | | MW: | 208.17 | | EINECS: | | | Product Categories: | | | Mol File: | 16929-37-6.mol | ![3-[(1-Carboxyvinyl)oxy]benzoic acid Structure](CAS/GIF/16929-37-6.gif) |
| | 3-[(1-Carboxyvinyl)oxy]benzoic acid Chemical Properties |
| Melting point | 150-152 °C | | Boiling point | 458.2±30.0 °C(Predicted) | | density | 1.401±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO: 1mg/mL | | pka | 3.26±0.11(Predicted) | | form | solid | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C10H8O5/c1-6(9(11)12)15-8-4-2-3-7(5-8)10(13)14/h2-5H,1H2,(H,11,12)(H,13,14) | | InChIKey | HGVAHYJMDVROLE-UHFFFAOYSA-N | | SMILES | O=C(O)C1=CC=CC(OC(C(O)=O)=C)=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 3-[(1-Carboxyvinyl)oxy]benzoic acid Usage And Synthesis |
| Uses | metabolomics
vitamins, nutraceuticals, and natural products | | Definition | ChEBI: 3-[(1-carboxyvinyl)oxy]benzoic acid is a dicarboxylic acid that is benzoic acid in which the hydrogen at position 3 is replaced by a (1-carboxyvinyl)oxy group. It is a member of benzoic acids, a dicarboxylic acid, an aromatic ether and an enol ether. It is functionally related to an acrylic acid. It is a conjugate acid of a 3-[(1-carboxylatovinyl)oxy]benzoate(2-). |
| | 3-[(1-Carboxyvinyl)oxy]benzoic acid Preparation Products And Raw materials |
|