- Triethylene glycol diacrylate
-
- $100.00 / 1KG
-
2025-09-25
- CAS:1680-21-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | Triethylene glycol diacrylate Basic information |
| Product Name: | Triethylene glycol diacrylate | | Synonyms: | TRIETHYLENE GLYCOL DIACRYLATE;1,2-ethanediylbis(oxy-2,1-ethanediyl) diacrylate;TEGdiacrylate;TEGDA;2,2'-(ethylenedioxy)diethyl diacrylate triethylene glycol diacrylate;2,2'-[Ethylenebis(oxy)]bisethanol diacrylate;Bisacrylic acid (ethylenebisoxybisethylene) ester;Bisacrylic acid ethylenebis(oxyethylene) ester | | CAS: | 1680-21-3 | | MF: | C12H18O6 | | MW: | 258.27 | | EINECS: | 216-853-9 | | Product Categories: | | | Mol File: | 1680-21-3.mol |  |
| | Triethylene glycol diacrylate Chemical Properties |
| Melting point | 125℃/2mm | | Boiling point | 266°C | | density | 1,1 g/cm3 | | refractive index | n20/D1.464 | | Fp | >100°C | | storage temp. | 2-8°C | | form | liquid | | Appearance | Colorless to light yellow Liquid | | Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/C12H18O6/c1-3-11(13)17-9-7-15-5-6-16-8-10-18-12(14)4-2/h3-4H,1-2,5-10H2 | | InChIKey | INQDDHNZXOAFFD-UHFFFAOYSA-N | | SMILES | C(OCCOC(=O)C=C)COCCOC(=O)C=C | | EPA Substance Registry System | Triethylene glycol diacrylate (1680-21-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-43-36/38 | | Safety Statements | 26-36/37/39-28 | | WGK Germany | 3 | | RTECS | AS8150000 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1 | | Toxicity | LD50 orl-rat: 500 mg/kg 85GMAT -,115,82 |
| | Triethylene glycol diacrylate Usage And Synthesis |
| Uses | Triethylene glycol diacrylate is a cross-linking acrylate monomer for use in coatings, adhesives, and printing plates of the photoprepolymer type. | | General Description | Triethyleneglycol dimethacrylate is used as an intermediate product for polymer synthesis in the chemical industry. | | reaction suitability | reagent type: cross-linking reagent
reaction type: Polymerization Reactions | | Safety Profile | Moderately toxic by
ingestion and skin contact. Questionable
carcinogen with experimental tumorigenic
data. Severe skin and eye irritant. When
heated to decomposition it emits acrid
smoke and irritating fumes. |
| | Triethylene glycol diacrylate Preparation Products And Raw materials |
|