- 2-Aminopyridine N-oxide
-
- $1.10 / 1g
-
2025-06-25
- CAS:14150-95-9
- Min. Order: 1g
- Purity: 99.0% min
- Supply Ability: 100 tons min
|
| | 2-Aminopyridine N-oxide Basic information |
| | 2-Aminopyridine N-oxide Chemical Properties |
| Melting point | 166°C | | Boiling point | 396.0±15.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | storage temp. | RT, protect from light, stored under nitrogen | | pka | pK1: 2.58(+1) (25°C) | | form | powder to crystal | | color | White to Light red to Green | | InChI | InChI=1S/C5H6N2O/c6-5-3-1-2-4-7(5)8/h1-4H,6H2 | | InChIKey | NNDASDMUUQRZKG-UHFFFAOYSA-N | | SMILES | C1(N)[N+]([O-])=CC=CC=1 | | CAS DataBase Reference | 14150-95-9(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Pyridinamine, 1-oxide(14150-95-9) |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-41-37/38-22 | | Safety Statements | 36/37/39-39-26 | | WGK Germany | WGK 3 | | HS Code | 2933.39.9200 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | 2-Aminopyridine N-oxide Usage And Synthesis |
| Uses | 2-Aminopyridine N-oxide is used as a raw material for organic synthesis. It can react with organic acids to prepare compounds such as (E)-2-(2-methylpent-2-enamido)pyridine 1-oxide, 2-(3,4-dihydro-2H-pyran-5-carboxamido)pyridine 1-oxide and (Z)-2-(3-ethoxy-2-methylpent-2-enamido)pyridine 1-oxide. | | Synthesis Reference(s) | Synthetic Communications, 7, p. 509, 1977 DOI: 10.1080/00397917709409270 |
| | 2-Aminopyridine N-oxide Preparation Products And Raw materials |
|