|
|
| | Sodium 3-methyl-2-oxobutanoate Basic information |
| Product Name: | Sodium 3-methyl-2-oxobutanoate | | Synonyms: | SodiuM 3-Methyl-2-oxobutyrate 95%;3-Methyl-D2, 4,4-D2, 98%);sodium dimethyl pyruvate;2-Keto-3-methylbutyric acid sodium salt;3-methyl-2-oxobutanoate;Sodium 3-methyl-2-oxobutanoate;SODIUM 3-METHYL-2-OXOBUTYRATE;SODIUM ALPHA-KETOISOVALERATE | | CAS: | 3715-29-5 | | MF: | C5H7NaO3 | | MW: | 138.1 | | EINECS: | 223-062-2 | | Product Categories: | Aliphatics;Intermediates | | Mol File: | 3715-29-5.mol |  |
| | Sodium 3-methyl-2-oxobutanoate Chemical Properties |
| Melting point | 220-230 °C (dec.) (lit.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | water: soluble100mg/mL, clear, colorless | | form | Crystalline Powder or Crystals | | color | White or slightly yellow to beige | | Odor | fruity | | Water Solubility | >54.8 mg/mL in Water | | JECFA Number | 631.1 | | BRN | 4334552 | | InChI | InChI=1S/C5H8O3.Na/c1-3(2)4(6)5(7)8;/h3H,1-2H3,(H,7,8);/q;+1/p-1 | | InChIKey | WIQBZDCJCRFGKA-UHFFFAOYSA-M | | SMILES | C(=O)(C([O-])=O)C(C)C.[Na+] | | LogP | -0.36 | | CAS DataBase Reference | 3715-29-5(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29183000 |
| | Sodium 3-methyl-2-oxobutanoate Usage And Synthesis |
| Chemical Properties | 3-Methyl-2-oxobutanoic acid has a fruity aroma. | | Chemical Properties | white or slightly yellow to beige crystalline | | Occurrence | Reported found in banana, bread, blue and provolone cheeses, asparagus, beer and cocoa | | Uses | Sodium 3-methyl-2-oxobutyrate (3-Methyl-2-oxobutanoic acid sodium salt) was used in the synthesis of (S)-2-hydroxy-3-methylbutanoic acid. | | Uses | An α-keto ester derivative. | | Definition | ChEBI: Sodium-3-methyl-2-oxobutyrate is an oxo carboxylic acid. | | in vitro | Sodium 3-methyl-2-oxobutanoate (alpha-Ketoisovaleric acid) is a precursor of pantothenic acid in Escherichia coli. Sodium 3-methyl-2-oxobutanoate (alpha-Ketoisovaleric acid) enhances alpha-ketoisocaproic acid and alpha-keto-beta-methyl-n-valeric acid but diminishes the corresponding amino acids and causes an early decline of ornithine along with a late augmentation of plasma arginine.
| | in vivo |
In rats, sodium 3-methyl-2-oxobutanoate (alpha-Ketoisovaleric acid) induces convulsions through GABAergic and glutamatergic mechanisms.
|
| | Sodium 3-methyl-2-oxobutanoate Preparation Products And Raw materials |
|