| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:o,p'-DDE
CAS:3424-82-6
Purity:100 μg/ML in MeOH Package:10Mg
|
|
| | O,P'-DDE Basic information |
| Product Name: | O,P'-DDE | | Synonyms: | 1-chloro-2-(2,2-dichloro-1-(4-chlorophenyl)ethenyl)-Benzene;1-chloro-2-[2,2-dichloro-1-(4-chlorophenyl)ethenyl]benzene;1-Chloro-2-[2,2-dichloro-1-(4-chlorophenyl)vinyl]benzene;2-(2-Chlorophenyl)-2-(4-chlorophenyl)-1,1-dichloroethylene;2-(o-Chlorophenyl)-2-(p’-chlorophenyl)-1,1-dichloroethene;2,2-(2-chlorophenyl-4’-chlorophenyl)-1,1-dichloroethene;Benzene, 1-chloro-2-[2,2-dichloro-1-(4-chlorophenyl)ethenyl]-;DDE,o,p’- | | CAS: | 3424-82-6 | | MF: | C14H8Cl4 | | MW: | 318.03 | | EINECS: | 222-318-0 | | Product Categories: | | | Mol File: | 3424-82-6.mol |  |
| | O,P'-DDE Chemical Properties |
| Melting point | 78.32°C | | Boiling point | 403.45°C (rough estimate) | | density | 1.3406 (rough estimate) | | refractive index | 1.6000 (estimate) | | Fp | 11 °C | | storage temp. | 2-8°C | | solubility | Chloroform: Heated; Methanol: Slightly Soluble | | form | A solid | | Water Solubility | 0.14mg/L(25 ºC) | | BRN | 1977640 | | Stability: | Hygroscopic | | Major Application | agriculture | | InChI | 1S/C14H8Cl4/c15-10-7-5-9(6-8-10)13(14(17)18)11-3-1-2-4-12(11)16/h1-8H | | InChIKey | ZDYJWDIWLRZXDB-UHFFFAOYSA-N | | SMILES | Clc1ccc(cc1)\C(=C(\Cl)Cl)c2ccccc2Cl | | EPA Substance Registry System | o,p'-DDE (3424-82-6) |
| Hazard Codes | Xn,N,T,F | | Risk Statements | 22-40-50/53-39/23/24/25-23/24/25-11 | | Safety Statements | 36/37-60-61-45-24-16-7 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 1 | | RTECS | KV9450000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 | | Toxicity | rat,LD50,oral,880mg/kg (880mg/kg),National Technical Information Service. Vol. PB85-143766, |
| | O,P'-DDE Usage And Synthesis |
| Uses | OP-DDE is a DDT metabolite that affects the estrogen and progesterone receptors. It has also been studied as a potential use in treatment of metastatic aderenal carcinoma. | | Definition | ChEBI: 2,2-(2-Chlorophenyl-4'-chlorophenyl)-1,1-dichloroethene is a diarylmethane. |
| | O,P'-DDE Preparation Products And Raw materials |
|