|
|
| Product Name: | 2PGA | | Synonyms: | (+)-2-O-Phosphono-D-glyceric acid;[R,(+)]-3-Hydroxy-2-(phosphonooxy)propanoic acid;2-O-Phosphono-D-glyceric acid;D-2-Phosphoglyceric acid lithium salt | | CAS: | 3443-57-0 | | MF: | C3H7O7P | | MW: | 186.06 | | EINECS: | | | Product Categories: | | | Mol File: | 3443-57-0.mol |  |
| Boiling point | 518.348±60.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.936±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | -20°C | | pka | 1.650±0.10(predicted) | | Major Application | clinical testing | | InChI | 1S/C3H7O7P/c4-1-2(3(5)6)10-11(7,8)9/h2,4H,1H2,(H,5,6)(H2,7,8,9) | | InChIKey | GXIURPTVHJPJLF-UHFFFAOYSA-N | | SMILES | [P](=O)(OC(CO)C(=O)O)(O)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| Uses | clinical testing | | Definition | ChEBI: 2-phospho-D-glyceric acid is a 2-phosphoglyceric acid in which the glyceric acid moiety has D (R) configuration. It has a role as an Escherichia coli metabolite, a Saccharomyces cerevisiae metabolite, a human metabolite and a mouse metabolite. It is functionally related to a D-glyceric acid. It is a conjugate acid of a 2-phosphonato-D-glycerate(3-). |
| | 2PGA Preparation Products And Raw materials |
|