- Boc-Trp-OH
-
- $0.00 / 25Kg/Drum
-
2026-05-09
- CAS:13139-14-5
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 500kgs
- Boc-Trp-OH
-
- $0.00 / 1kg
-
2026-05-08
- CAS:13139-14-5
- Min. Order: 1kg
- Purity: 97%
- Supply Ability: 20ton
|
| | N-[(tert-Butoxy)carbonyl]-L-tryptophan Basic information |
| | N-[(tert-Butoxy)carbonyl]-L-tryptophan Chemical Properties |
| Melting point | 136 °C (dec.)(lit.) | | alpha | -20 º (c=1, methanol) | | Boiling point | 445.17°C (rough estimate) | | density | 1.1328 (rough estimate) | | refractive index | -17.5 ° (C=2, DMF) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 4.00±0.10(Predicted) | | form | Powder | | color | White to off-white | | Optical Rotation | [α]20/D 20±1°, c = 1% in DMF | | BRN | 39677 | | Major Application | peptide synthesis | | InChI | 1S/C16H20N2O4/c1-16(2,3)22-15(21)18-13(14(19)20)8-10-9-17-12-7-5-4-6-11(10)12/h4-7,9,13,17H,8H2,1-3H3,(H,18,21)(H,19,20)/t13-/m0/s1 | | InChIKey | NFVNYBJCJGKVQK-ZDUSSCGKSA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(O)=O | | CAS DataBase Reference | 13139-14-5(CAS DataBase Reference) | | EPA Substance Registry System | L-Tryptophan, N-[(1,1-dimethylethoxy)carbonyl]- (13139-14-5) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 22-24/25-36-26 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | N-[(tert-Butoxy)carbonyl]-L-tryptophan Usage And Synthesis |
| Chemical Properties | WHITE TO OFF-WHITE GRANULAR POWDER | | Uses | Nα-Boc-L-tryptophan is an N-Boc-protected form of L-Tryptophan (T947210). L-Tryptophan is an essential amino acid that is important for cell proliferation and the biosynthesis of proteins. It is a precursor to Serotonin (HCl: S274980), a neurotransmitter that compound that aids in sleep and mental state. L-Tryptophan is also thought to cause eosinophilia-myalgia syndrome. | | Definition | ChEBI: N-[(Tert-butoxy)carbonyl]-L-tryptophan is an indolyl carboxylic acid. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | N-[(tert-Butoxy)carbonyl]-L-tryptophan Preparation Products And Raw materials |
|