|
|
| | (4R-Cis)-6-Hydroxymethyl-2,2-dimethyl-1,3-dioxane-4-acetic acid 1,1-dimethylethyl ester Basic information |
| Product Name: | (4R-Cis)-6-Hydroxymethyl-2,2-dimethyl-1,3-dioxane-4-acetic acid 1,1-dimethylethyl ester | | Synonyms: | D-6 (4R-Cis)-6-HydroxyMethyl-2,2-DiMethyl-1,3-Dioxane-4-AceticAcid,1,1-DiMethylthylEster;tert-Butyl (4R,6S)-6-(Hydroxymethyl)-2,2-dimethyl-1,3-dioxane-4-acetate;rosuvastatin intermediatesC-5;T-BUTYL-(3R,5S)-6-HYDROXY 3,5-O-ISOPROPYLIDENE 3,5-DIHYDROXYHEXANOATE;TERT-BUTYL [(4R,6S)-6-(HYDROXYMETHYL)-2,2-DIMETHYL-1,3-DIOXANE-4-YL] ACETATE;TERT-BUTYL (3R,5S)-6-HYDROXY 3,5-O-ISOPROPYLIDENE-3,5-DIHYDROXYHEXANOATE;2-[(4r,6s)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid tert-butyl ester;(6S-Hydroxymethyl-2,2-dimethyl-[1,3]dioxan-4R-yl)acetic acid tert-butyl ester | | CAS: | 124655-09-0 | | MF: | C13H24O5 | | MW: | 260.33 | | EINECS: | 432-960-5 | | Product Categories: | chiral;Chiral Reagents;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 124655-09-0.mol |  |
| | (4R-Cis)-6-Hydroxymethyl-2,2-dimethyl-1,3-dioxane-4-acetic acid 1,1-dimethylethyl ester Chemical Properties |
| Boiling point | 331°C | | density | 1.030 | | refractive index | 1.4500-1.4540 | | Fp | 113°C | | storage temp. | Inert atmosphere,2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 14.25±0.10(Predicted) | | form | Oil | | color | Pale Yellow to Brown | | InChI | InChI=1S/C13H24O5/c1-12(2,3)18-11(15)7-9-6-10(8-14)17-13(4,5)16-9/h9-10,14H,6-8H2,1-5H3/t9-,10-/m0/s1 | | InChIKey | CFRUAOXMCVQMFP-ZJUUUORDSA-N | | SMILES | C(OC(C)(C)C)(=O)C[C@@H]1C[C@@H](CO)OC(O1)(C)C | | CAS DataBase Reference | 124655-09-0(CAS DataBase Reference) |
| | (4R-Cis)-6-Hydroxymethyl-2,2-dimethyl-1,3-dioxane-4-acetic acid 1,1-dimethylethyl ester Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui | | Uses | (4R-Cis)-6-Hydroxymethyl-2,2-dimethyl-1,3-dioxane-4-acetic acid 1,1-dimethylethyl ester is a useful synthetic intermediate. | | Uses | A useful synthetic intermediate in the preparation of Rosuvastatin (R700500) and its derivatives |
| | (4R-Cis)-6-Hydroxymethyl-2,2-dimethyl-1,3-dioxane-4-acetic acid 1,1-dimethylethyl ester Preparation Products And Raw materials |
|