|
|
| | Ethyl 2,6-dichloro-5-fluoro-pyridine-3-acetoacetate Basic information |
| Product Name: | Ethyl 2,6-dichloro-5-fluoro-pyridine-3-acetoacetate | | Synonyms: | 3-Pyridinepropanoic acid, 2,6-dichloro-5-fluoro-b-oxo-, ethyl ester;Ethyl 2,6-dichloro-5-fluoro-b-oxo-3-pyridinepropanoate;Ethyl 3-[2,6-dichloro-5-fluoro-(3-pyridiyl)]-3-oxopropanoate ,98%;Ethyl 3-(2,6-Dichloro-5-fluoro-3-pyridyl)-3-oxopropionate;Ethyl 3-[2,6-dichloro-5-fluoro-(3-pyridiyl)]-3-oxopropanoate,97%;ethyl 2-(2,6-dichloro-5-fluoropyridin-3-yl)-3-oxobutanoate;2,6-Dichloro-5-Fluoronicothinic acetale;Ethyl 2,6-dichloro-5-fluornicotinoylacetate ,98% | | CAS: | 96568-04-6 | | MF: | C10H8Cl2FNO3 | | MW: | 280.08 | | EINECS: | 627-012-4 | | Product Categories: | Aromatics;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals;C9 to C46Heterocyclic Building Blocks;Halogenated Heterocycles;Heterocyclic Building Blocks;Pyridines;Intermediate of Enoxacin;Pharmaceutical Intermediates | | Mol File: | 96568-04-6.mol |  |
| | Ethyl 2,6-dichloro-5-fluoro-pyridine-3-acetoacetate Chemical Properties |
| Melting point | 68-72 °C (lit.) | | Boiling point | 349.9±37.0 °C(Predicted) | | density | 1.4602 (estimate) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 9.43±0.50(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C10H8Cl2FNO3/c1-2-17-8(16)4-7(15)5-3-6(13)10(12)14-9(5)11/h3H,2,4H2,1H3 | | InChIKey | IEUHWNLWVMLHHC-UHFFFAOYSA-N | | SMILES | C(C1C=C(F)C(Cl)=NC=1Cl)(=O)CC(=O)OCC | | CAS DataBase Reference | 96568-04-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Ethyl 2,6-dichloro-5-fluoro-pyridine-3-acetoacetate Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Enoxacin intermediate. | | General Description | Ethyl 2,6-dichloro-5-fluoro-β-oxo-3-pyridinepropionate is a β-keto ester. |
| | Ethyl 2,6-dichloro-5-fluoro-pyridine-3-acetoacetate Preparation Products And Raw materials |
| Raw materials | Propanedioic acid, 2-[(2,6-dichloro-5-fluoro-3-pyridinyl)carbonyl]-, 1,3-diethyl ester-->Diethyl Ethoxymagnesiomalonate-->2,6-DICHLORO-5-FLUORONICOTINOYL CHLORIDE-->ethyl 2,6-dichloro-5-fluoropyridine-3-carboxylate-->2,6-Dichloro-5-fluoronicotinic acid-->2,6-Dihydroxy-5-fluoro-3-cyanopyridine-->2,6-Dichloro-5-fluoronicotinamide-->2,6-Dichloro-5-fluoro-3-pyridinecarbonitrile-->Ethyl potassium malonate-->Ethyl hydrogen malonate | | Preparation Products | Ethyl-2-(2,6-dichlor-5-fluorpyridin-3-carbonyl)-3-(2,4-difluorphenylamino)-acrylat |
|