- Xylobiose
-
- $0.00 / 10G
-
2026-02-26
- CAS:6860-47-5
- Min. Order: 10G
- Purity: 98%min
- Supply Ability: 30kg/month
- XYLOBIOSE
-
- $48.00 / 5mg
-
2026-02-25
- CAS:6860-47-5
- Min. Order:
- Purity: 99.93%
- Supply Ability: 10g
- XYLOBIOSE
-
- $0.00 / 1kg
-
2025-04-04
- CAS:6860-47-5
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1Ton
|
| | XYLOBIOSE Basic information |
| Product Name: | XYLOBIOSE | | Synonyms: | 1,4-D-XYLOBIOSE;XYLOBIOSE;D-Xylose, 4-O-.beta.-D-xylopyranosyl-;1,4-beta-Xylobiose;4-O-β-D-Xylopyranosyl-β-D-xylopyranose;4-O-(β-D-Xylopyranosyl)-D-xylose;β-1,4-Xylobiose;C01630 | | CAS: | 6860-47-5 | | MF: | C10H18O9 | | MW: | 282.24 | | EINECS: | | | Product Categories: | | | Mol File: | 6860-47-5.mol |  |
| | XYLOBIOSE Chemical Properties |
| Melting point | 186-187 °C | | Boiling point | 604.0±55.0 °C(Predicted) | | density | 1.61±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Water (Slightly) | | pka | 12.40±0.20(Predicted) | | form | powder | | color | White to Off-White | | Optical Rotation | -40 → -27 | | Stability: | Stable under recommended storage conditions., Stable Under Recommended Storage C | | Cosmetics Ingredients Functions | SKIN CONDITIONING
HUMECTANT | | InChI | 1S/C10H18O9/c11-1-4(13)7(15)6(2-12)19-10-9(17)8(16)5(14)3-18-10/h1,4-10,12-17H,2-3H2 | | InChIKey | LGQKSQQRKHFMLI-WSNPFVOISA-N | | SMILES | OCC(OC1OCC(O)C(O)C1O)C(O)C(O)C=O | | CAS DataBase Reference | 6860-47-5 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids |
| | XYLOBIOSE Usage And Synthesis |
| Uses | Xylobiose is a disaccharide that can reduce the blood sugar and blood fat and inhibit the fat accumulation of diet-induced obese rats. | | Definition | ChEBI: Xylobiose is a glycosylxylose that is D-xylopyranose having a beta-D-xylopyranosyl residue attached at position 4 via a glycosidic bond. It has a role as a bacterial metabolite. |
| | XYLOBIOSE Preparation Products And Raw materials |
|