|
|
| | 1,4-PHENYLENEBIS(THIOUREA) Basic information |
| Product Name: | 1,4-PHENYLENEBIS(THIOUREA) | | Synonyms: | 1,1’-p-phenylenebis(2-thio-ure;1,1’-p-phenylenebis(2-thiourea);n,n’’-1,4-phenylenebis-thioure;1,4-PHENYLENEBIS(2-THIOUREA);1,4-PHENYLENEBIS(THIOUREA);1,4-PHENYLENEBIS(THIOUREA), 98+%;N,N"-1,4-Phenylenebis(thiourea), 98+%;N,N''-1,4-Phenylenebis(thiourea) | | CAS: | 1519-70-6 | | MF: | C8H10N4S2 | | MW: | 226.32 | | EINECS: | | | Product Categories: | | | Mol File: | 1519-70-6.mol |  |
| | 1,4-PHENYLENEBIS(THIOUREA) Chemical Properties |
| Melting point | 219-220°C (dec.) | | Boiling point | 405.1±55.0 °C(Predicted) | | density | 1.553±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 12.57±0.70(Predicted) | | Appearance | Light yellow to yellow Solid | | BRN | 2114854 | | InChI | InChI=1S/C8H10N4S2/c9-7(13)11-5-1-2-6(4-3-5)12-8(10)14/h1-4H,(H3,9,11,13)(H3,10,12,14) | | InChIKey | AMNPXXIGUOKIPP-UHFFFAOYSA-N | | SMILES | C1(NC(N)=S)=CC=C(NC(N)=S)C=C1 | | CAS DataBase Reference | 1519-70-6 |
| Risk Statements | 22 | | Safety Statements | 22-36/37 | | RIDADR | 2811 | | RTECS | YU1292010 | | HazardClass | 6.1 | | PackingGroup | III | | Toxicity | rat,LD,oral,> 500mg/kg (500mg/kg),National Academy of Sciences, National Research Council, Chemical-Biological Coordination Center, Review. Vol. 5, Pg. 45, 1953. |
| Provider | Language |
|
ALFA
| English |
| | 1,4-PHENYLENEBIS(THIOUREA) Usage And Synthesis |
| | 1,4-PHENYLENEBIS(THIOUREA) Preparation Products And Raw materials |
|