- X-Gluc sodium
-
- $0.00 / 1removed
-
2026-01-27
- CAS:129541-41-9
- Min. Order:
- Purity: 99.13%
- Supply Ability: 10g
|
| | 5-Bromo-4-chloro-3-indolyl-beta-D-glucuronide sodium salt Basic information |
| | 5-Bromo-4-chloro-3-indolyl-beta-D-glucuronide sodium salt Chemical Properties |
| Melting point | 228-230°C | | storage temp. | -20°C | | solubility | deionized water: solubleone tablet, 5mg/mL | | form | tablet | | color | White to Almost white | | Water Solubility | Soluble in water at 10mg/ml | | Sensitive | Light Sensitive | | InChI | InChI=1/C14H13BrClNO7.Na.H/c15-4-1-2-5-7(8(4)16)6(3-17-5)23-14-11(20)9(18)10(19)12(24-14)13(21)22;;/h1-3,9-12,14,17-20H,(H,21,22);;/t9-,10-,11+,12-,14+;;/s3 | | InChIKey | KSEGXDRRKCCCGG-BTCNKGGSSA-M | | SMILES | O([C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](C(=O)O)O1)O)C1=CNC2=CC=C(Br)C(Cl)=C12.[NaH] |&1:1,2,3,5,7,r| | | CAS DataBase Reference | 129541-41-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-37/39-26 | | WGK Germany | 3 | | HS Code | 29339990 | | Storage Class | 11 - Combustible Solids |
| | 5-Bromo-4-chloro-3-indolyl-beta-D-glucuronide sodium salt Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | XGLUC, Sodium Salt is a chromogenic substrate for β-glucuronidase (GUS) gene detection. | | Uses | 5-Bromo-4-chloro-3-indolyl-beta-D-glucuronide sodium salt is a substrate for -Glucuronidase that is converted by the enzyme into an intense blue prepicitate. It is used for the detection of the Gus gene in bacterial colonies, e.g. Escherichia Coli, or for histochemical applications | | Biochem/physiol Actions | 5-bromo-4-chloro-3-indolyl-β-D-glucuronide sodium salt (X-GlcA), a colorless substrate for β-glucuronidase enzyme, generates a blue color at the end of the reaction. |
| | 5-Bromo-4-chloro-3-indolyl-beta-D-glucuronide sodium salt Preparation Products And Raw materials |
|