- 2,4-Dinitrobenzaldehyde
-
- $0.00 / 1g
-
2026-02-02
- CAS:528-75-6
- Min. Order: 10mg
- Purity: 99%HPLC
- Supply Ability: 2000tons
|
| | 2,4-Dinitrobenzaldehyde Basic information |
| | 2,4-Dinitrobenzaldehyde Chemical Properties |
| Melting point | 66-70 °C (lit.) | | Boiling point | 190 °C/10 mmHg (lit.) | | density | 1.6665 (rough estimate) | | refractive index | 1.5300 (estimate) | | Fp | 190°C/10mm | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | Light Brown to Light Red | | Sensitive | Air Sensitive | | Merck | 14,3272 | | BRN | 1878706 | | InChI | InChI=1S/C7H4N2O5/c10-4-5-1-2-6(8(11)12)3-7(5)9(13)14/h1-4H | | InChIKey | ZILXIZUBLXVYPI-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O | | CAS DataBase Reference | 528-75-6(CAS DataBase Reference) | | NIST Chemistry Reference | 2,4-Dinitrobenzaldehyde(528-75-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | CU5957000 | | Hazard Note | Irritant | | HS Code | 29124990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,4-Dinitrobenzaldehyde Usage And Synthesis |
| Chemical Properties | Yellow to light brown crystals with a melting point of 72°C. Soluble in ethanol and ether, soluble in benzene and glacial acetic acid, slightly soluble in water. Easily sublimated by heat. | | Uses | 2,4-Dinitrobenzaldehyde is a reagent used in the preparation of Schiff bases. |
| | 2,4-Dinitrobenzaldehyde Preparation Products And Raw materials |
|