- Furil
-
- $1.00
-
2025-12-12
- CAS:492-94-4
- Min. Order: 1KG
- Purity: 95%
- Supply Ability: 7000KG
- Furil
-
- $1.00
-
2020-01-09
- CAS:492-94-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000KGS
|
| | Furil Chemical Properties |
| Melting point | 163-165 °C (lit.) | | Boiling point | 245.64°C (rough estimate) | | density | 1.1083 (rough estimate) | | refractive index | 1.4440 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | Yellow | | BRN | 383882 | | InChI | InChI=1S/C10H6O4/c11-9(7-3-1-5-13-7)10(12)8-4-2-6-14-8/h1-6H | | InChIKey | SXPUVBFQXJHYNS-UHFFFAOYSA-N | | SMILES | C(C1=CC=CO1)(=O)C(C1=CC=CO1)=O | | CAS DataBase Reference | 492-94-4(CAS DataBase Reference) | | NIST Chemistry Reference | Ethanedione, di-2-furanyl-(492-94-4) | | EPA Substance Registry System | Ethanedione, di-2-furanyl- (492-94-4) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | RTECS | LV0580000 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29321900 | | Storage Class | 11 - Combustible Solids |
| | Furil Usage And Synthesis |
| Chemical Properties | YELLOW-BROWN CRYSTALLINE POWDER | | Uses | Furil was used in preparation of dioxomolybdenum(VI) complexes in situ. | | General Description | Furil undergoes catalytic asymmetric transfer hydrogenation to yield hydrofuroin. | | Purification Methods | Furil crystallises from MeOH or *benzene (charcoal). [Beilstein 19 III/IV 2008.] |
| | Furil Preparation Products And Raw materials |
|