|
|
| | 2-[(4-Chlorophenyl)(4-piperidinyloxy)methyl]pyridine Basic information | | Uses |
| Product Name: | 2-[(4-Chlorophenyl)(4-piperidinyloxy)methyl]pyridine | | Synonyms: | 2-[(4-chlorophenyl)(4-piperidinyloxy)Methyl]-;2-[(4-chlorophenyl)(4-piperidinyloxy)Methyl]-Pyridine(for Bepotastine);2-[(4-Chlorophenyl)(Piperidine-4-yloxy)Methyl]Pyridine;(piperidin-4-yloxy);2-((4-Chlorophenyl) (4-piperdinnyloxy) methyl pyridine;2-[(4-Chlorophenyl)(4-piperidinyloxy)methyl]pyridine;4-[1-(4-chlorophenyl)-1-(2-pyridyl)methoxy]piperidine;4-((chlorophenyl)-(2-pyridinyl)methoxy)piperidine | | CAS: | 122368-54-1 | | MF: | C17H19ClN2O | | MW: | 302.8 | | EINECS: | 1806241-263-5 | | Product Categories: | | | Mol File: | 122368-54-1.mol | ![2-[(4-Chlorophenyl)(4-piperidinyloxy)methyl]pyridine Structure](CAS/GIF/122368-54-1.gif) |
| | 2-[(4-Chlorophenyl)(4-piperidinyloxy)methyl]pyridine Chemical Properties |
| Melting point | 62-65°C | | Boiling point | 421.7±45.0 °C(Predicted) | | density | 1.21 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), DMSO (Slightly) | | form | Solid | | pka | 9.71±0.10(Predicted) | | color | Pale Brown to Light Brown | | InChI | InChI=1S/C17H19ClN2O/c18-14-6-4-13(5-7-14)17(16-3-1-2-10-20-16)21-15-8-11-19-12-9-15/h1-7,10,15,17,19H,8-9,11-12H2 | | InChIKey | OTZYADIPHOGUDN-UHFFFAOYSA-N | | SMILES | C1(C(C2=CC=C(Cl)C=C2)OC2CCNCC2)=NC=CC=C1 |
| | 2-[(4-Chlorophenyl)(4-piperidinyloxy)methyl]pyridine Usage And Synthesis |
| Uses | 2-[(4-Chlorophenyl)(4-piperidinyloxy)methyl]pyridine is an intermediate in the synthesis of Bepotastine besylate, a non-sedating H1-antagonist that has anti-inflammatory activity. | | Chemical Properties | Brown liquid | | Uses | 2-[(4-Chlorophenyl)(4-piperidinyloxy)methyl]pyridine is an intermediate in the synthesis of Bepotastine besylate (B317000), a non-sedating H1-antagonist that has anti-inflammatory activity. |
| | 2-[(4-Chlorophenyl)(4-piperidinyloxy)methyl]pyridine Preparation Products And Raw materials |
|