|
|
| | 3,4,6-Tribromopyridazine Basic information | | Uses |
| | 3,4,6-Tribromopyridazine Chemical Properties |
| Boiling point | 382.6±37.0 °C(Predicted) | | density | 2.545±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -2.72±0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C4HBr3N2/c5-2-1-3(6)8-9-4(2)7/h1H | | InChIKey | ZRPHMOREEBHHIM-UHFFFAOYSA-N | | SMILES | C1(Br)=NN=C(Br)C=C1Br |
| | 3,4,6-Tribromopyridazine Usage And Synthesis |
| Uses | 3,4,6-Tribromopyridazine is a heterocyclic derivative and can be used as a pharmaceutical intermediate. | | Description | 3,4,6-Tribromopyridazine is a useful research chemical compound. |
| | 3,4,6-Tribromopyridazine Preparation Products And Raw materials |
|