|
|
| | N-methylbiphenyl-2-amine Basic information |
| Product Name: | N-methylbiphenyl-2-amine | | Synonyms: | N-methylbiphenyl-2-amine;N-Methyl-(1,1'-biphenyl)-2-aMine;2-(Methylamino)biphenyl;N-Methyl-2-biphenylylamine;o-(N-Methylamino)biphenyl;2-(N-Methylamino)-1,1'-biphenyl;[1,1'-Biphenyl]-2-amine, N-methyl-;2-(N-METHYLAMINO)-1,1'-BIPHENYL,MIN.95% | | CAS: | 14925-09-8 | | MF: | C13H13N | | MW: | 183.25 | | EINECS: | | | Product Categories: | Achiral Nitrogen | | Mol File: | 14925-09-8.mol |  |
| | N-methylbiphenyl-2-amine Chemical Properties |
| Boiling point | 330.0±21.0 °C(Predicted) | | density | 1.052 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | liquid | | pka | 4.17±0.10(Predicted) | | color | pale-yellow | | Sensitive | air sensitive | | InChI | InChI=1S/C13H13N/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10,14H,1H3 | | InChIKey | CARILLOXVAEKID-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)=CC=CC=C1NC |
| | N-methylbiphenyl-2-amine Usage And Synthesis |
| | N-methylbiphenyl-2-amine Preparation Products And Raw materials |
|