| Company Name: |
Henan Lien Chemical Products Co., Ltd. Gold
|
| Tel: |
03716091-9097 13383857418 |
| Email: |
1520689222@qq.com |
| Products Intro: |
Product Name:N1-(2-(Dimethylamino)phenyl)-N2,N2-dimethylbenzene-1,2-diamine
CAS:1072901-09-7
Purity:98%
|
| Company Name: |
LaaJoo
|
| Tel: |
021-60702684 18516024827 |
| Email: |
huang.jiayi@sinocompound.com |
| Products Intro: |
CAS:1072901-09-7
Purity:95% Package:1g;200mg
|
| Company Name: |
Henan's chemical products co., LTD
|
| Tel: |
0371-60919097 15378766539 |
| Email: |
794449696@qq.com |
| Products Intro: |
Product Name:N1-(2-(Dimethylamino)phenyl)-N2,N2-dimethylbenzene-1,2-diamine
CAS:1072901-09-7
Purity:98% Package:25g 50g 100g 250g 500g
|
|
| | Pincer ligand Basic information |
| Product Name: | Pincer ligand | | Synonyms: | Pincer ligand;N2-[2-(Dimethylamino)phenyl]-N1,N1-dimethyl-1,2-benzenediamine;Bis[(2-diMethylaMino)phenyl]aMine;1,2-Benzenediamine, N2-[2-(dimethylamino)phenyl]-N1,N1-dimethyl-;1-N-[2-(Dimethylamino)phenyl]-2-N,2-N-dimethylbenzene-1,2-diamine;N1-(2-(Dimethylamino)phenyl)-N2,N2-dimethylbenzene-1,2-diamine | | CAS: | 1072901-09-7 | | MF: | C16H21N3 | | MW: | 255.36 | | EINECS: | | | Product Categories: | Achiral Nitrogen;Py-N | | Mol File: | 1072901-09-7.mol |  |
| | Pincer ligand Chemical Properties |
| Boiling point | 356.5±27.0 °C(Predicted) | | density | 1.103±0.06 g/cm3(Predicted) | | pka | 7.17±0.50(Predicted) | | InChI | InChI=1S/C16H21N3/c1-18(2)15-11-7-5-9-13(15)17-14-10-6-8-12-16(14)19(3)4/h5-12,17H,1-4H3 | | InChIKey | JAEMXIQPMPWWNY-UHFFFAOYSA-N | | SMILES | C1(N(C)C)=CC=CC=C1NC1=CC=CC=C1N(C)C |
| | Pincer ligand Usage And Synthesis |
| | Pincer ligand Preparation Products And Raw materials |
|