|
|
| | 7-Bromo-4-chloro-2,8-dimethylquinoline Basic information |
| | 7-Bromo-4-chloro-2,8-dimethylquinoline Chemical Properties |
| storage temp. | Storage temp. 2-8°C | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C11H9BrClN/c1-6-5-10(13)8-3-4-9(12)7(2)11(8)14-6/h3-5H,1-2H3 | | InChIKey | JJOXAYSGWSYGNB-UHFFFAOYSA-N | | SMILES | Cc1cc(Cl)c2ccc(Br)c(C)c2n1 |
| Hazard Codes | T | | Risk Statements | 25-41 | | Safety Statements | 26-39-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HS Code | 2933998090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 4 Eye Dam. 1 |
| | 7-Bromo-4-chloro-2,8-dimethylquinoline Usage And Synthesis |
| | 7-Bromo-4-chloro-2,8-dimethylquinoline Preparation Products And Raw materials |
|