|
|
| | methyl 4-(tert-butoxycarbonylamino)benzoate Basic information |
| Product Name: | methyl 4-(tert-butoxycarbonylamino)benzoate | | Synonyms: | Methyl 4-(tert-butoxycarbonylamino)benzenecarboxylate;4-(Boc-amino)benzoic acid methyl ester;4-tert-butoxycarbonylamino-benzoic acid methyl ester;methyl 4-(tert-butoxycarbonylamino)benzoate;Methyl 4-(BOC-aMino)benzoate;Benzoic acid, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-, methyl ester | | CAS: | 164596-20-7 | | MF: | C13H17NO4 | | MW: | 251.28 | | EINECS: | | | Product Categories: | | | Mol File: | 164596-20-7.mol |  |
| | methyl 4-(tert-butoxycarbonylamino)benzoate Chemical Properties |
| Melting point | 163-166°C | | Boiling point | 314.5±25.0 °C(Predicted) | | density | 1.161±0.06 g/cm3(Predicted) | | pka | 13.29±0.70(Predicted) | | form | solid | | InChI | 1S/C13H17NO4/c1-13(2,3)18-12(16)14-10-7-5-9(6-8-10)11(15)17-4/h5-8H,1-4H3,(H,14,16) | | InChIKey | XUFDEWYARHDJQD-UHFFFAOYSA-N | | SMILES | COC(=O)c1ccc(NC(=O)OC(C)(C)C)cc1 |
| Hazard Codes | Xn | | Risk Statements | 22-43-52/53 | | Safety Statements | 36/37-61 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
| | methyl 4-(tert-butoxycarbonylamino)benzoate Usage And Synthesis |
| Uses | Methyl 4-(Boc-amino)benzoate is an impuriy of α,α-Bis[4-(dimethylamino)phenyl]-4-(methylamino)-benzenemethanol which is a product from degradation of methyl green. |
| | methyl 4-(tert-butoxycarbonylamino)benzoate Preparation Products And Raw materials |
|