|
|
| | 3-amino-2-methylpropan-1-ol Basic information |
| Product Name: | 3-amino-2-methylpropan-1-ol | | Synonyms: | 3-Amino-2-Methylprop;3-aMino-2-Methyl-1-propanol;3-amino-2-methylpropan-1-ol;3-amino-2-methyl-1-propanol(SALTDATA: FREE);1-Propanol, 3-aMino-2-Methyl-;3-amino-2-methyl-propyl-1-ol | | CAS: | 15518-10-2 | | MF: | C4H11NO | | MW: | 89.14 | | EINECS: | | | Product Categories: | | | Mol File: | 15518-10-2.mol |  |
| | 3-amino-2-methylpropan-1-ol Chemical Properties |
| Boiling point | 100-105 °C(Press: 14 Torr) | | density | 0.927±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 14.85±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C4H11NO/c1-4(2-5)3-6/h4,6H,2-3,5H2,1H3 | | InChIKey | FVXBTPGZQMNAEZ-UHFFFAOYSA-N | | SMILES | C(O)C(C)CN |
| | 3-amino-2-methylpropan-1-ol Usage And Synthesis |
| | 3-amino-2-methylpropan-1-ol Preparation Products And Raw materials |
|