tert-butyl 2-(chloromethyl)-1H-benzimidazole-1-carboxylate manufacturers
|
| | tert-butyl 2-(chloromethyl)-1H-benzimidazole-1-carboxylate Basic information |
| Product Name: | tert-butyl 2-(chloromethyl)-1H-benzimidazole-1-carboxylate | | Synonyms: | tert-butyl 2-(chloromethyl)-1H-benzimidazole-1-carboxylate;1-(tert-Butoxycarbonyl)-2-(chloromethyl)-benzimidazole;tert-butyl 2-(chloroMethyl)-1H-benzo[d]iMidazole-1-carboxylate;1H-BenziMidazole-1-carboxylic acid, 2-(chloroMethyl)-, 1,1-diMethylethyl ester;tert-butyl 2-(chloromethyl)-1H-1,3-benzodiazole-1-carboxylate;Tert-butyl-2 - (chloromethyl) - 1H-benzimidazole-1-carboxylate tert-butyl ester;1-Boc-2-(chloromethyl)benzimidazole;tert-butyl 2-(chloromethyl)-1H-benzimidazole-1-carbo | | CAS: | 163798-87-6 | | MF: | C13H15ClN2O2 | | MW: | 266.72 | | EINECS: | | | Product Categories: | | | Mol File: | 163798-87-6.mol |  |
| | tert-butyl 2-(chloromethyl)-1H-benzimidazole-1-carboxylate Chemical Properties |
| Boiling point | 377.6±44.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 2.01±0.10(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C13H15ClN2O2/c1-13(2,3)18-12(17)16-10-7-5-4-6-9(10)15-11(16)8-14/h4-7H,8H2,1-3H3 | | InChIKey | YNZUHDHIWWRGOR-UHFFFAOYSA-N | | SMILES | C1(CCl)N(C(OC(C)(C)C)=O)C2=CC=CC=C2N=1 |
| | tert-butyl 2-(chloromethyl)-1H-benzimidazole-1-carboxylate Usage And Synthesis |
| Uses | tert-butyl 2-(chloromethyl)-1H-benzimidazole-1-carboxylate is used in organic synthesis. |
| | tert-butyl 2-(chloromethyl)-1H-benzimidazole-1-carboxylate Preparation Products And Raw materials |
|