|
|
| | 1,4-Dihydronicotinamide mononucleotide Basic information |
| Product Name: | 1,4-Dihydronicotinamide mononucleotide | | Synonyms: | 1,4-Dihydronicotinamide mononucleotide;((2R,3S,4R,5R)-5-(3-Carbamoylpyridin-1(4H)-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl dihydrogen phosphate;3-Pyridinecarboxamide, 1,4-dihydro-1-(5-O-phosphono-β-D-ribofuranosyl)- | | CAS: | 4229-56-5 | | MF: | C11H17N2O8P | | MW: | 336.23 | | EINECS: | | | Product Categories: | | | Mol File: | 4229-56-5.mol |  |
| | 1,4-Dihydronicotinamide mononucleotide Chemical Properties |
| Boiling point | 724.0±70.0 °C(Predicted) | | density | 1.728±0.06 g/cm3(Predicted) | | pka | 1.86±0.10(Predicted) | | InChI | InChI=1S/C11H17N2O8P/c12-10(16)6-2-1-3-13(4-6)11-9(15)8(14)7(21-11)5-20-22(17,18)19/h1,3-4,7-9,11,14-15H,2,5H2,(H2,12,16)(H2,17,18,19)/t7-,8-,9-,11-/m1/s1 | | InChIKey | XQHMUSRSLNRVGA-TURQNECASA-N | | SMILES | C1N([C@@H]2O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]2O)C=CCC=1C(N)=O |
| | 1,4-Dihydronicotinamide mononucleotide Usage And Synthesis |
| Definition | ChEBI: NMNH is a nicotinamide mononucleotide that is obtained by addition of hydride to position 4 on the pyridine ring of NMN(+). It has a role as a metabolite. It is functionally related to a NMN(+). It is a conjugate acid of a NMNH(2-). |
| | 1,4-Dihydronicotinamide mononucleotide Preparation Products And Raw materials |
|