| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Bromo-4-(methylsulfonyl)toluene Basic information |
| Product Name: | 2-Bromo-4-(methylsulfonyl)toluene | | Synonyms: | 2-Bromo-4-(methylsulfonyl)toluene;2-Bromo-1-methyl-4-(methylsulfonyl)benzene;2-Bromo-4-methylsulfonyl-1-methylbenzene;Benzene, 2-bromo-1-methyl-4-(methylsulfonyl)- | | CAS: | 702672-96-6 | | MF: | C8H9BrO2S | | MW: | 249.12 | | EINECS: | | | Product Categories: | | | Mol File: | 702672-96-6.mol |  |
| | 2-Bromo-4-(methylsulfonyl)toluene Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H9BrO2S/c1-6-3-4-7(5-8(6)9)12(2,10)11/h3-5H,1-2H3 | | InChIKey | AIRSBUZFXFIKHJ-UHFFFAOYSA-N | | SMILES | C1(C)=CC=C(S(C)(=O)=O)C=C1Br |
| | 2-Bromo-4-(methylsulfonyl)toluene Usage And Synthesis |
| | 2-Bromo-4-(methylsulfonyl)toluene Preparation Products And Raw materials |
|