| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Carboxy-2-fluorophenylboronic acid pinacol ester Basic information |
| Product Name: | 4-Carboxy-2-fluorophenylboronic acid pinacol ester | | Synonyms: | 4-Carboxy-2-fluorophenylboronic acid pinacol ester;4-Carboxy-2-fluorobenzeneboronic acid pinacol ester, 96%;4-BORONO-3-FLUOROBENZOIC ACID PINACOL ESTER;Benzoic acid, 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-;4-Carboxy-2-fluorobenzeneboronic acid pinacol ester;3-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid | | CAS: | 1050423-87-4 | | MF: | C13H16BFO4 | | MW: | 266.07 | | EINECS: | | | Product Categories: | | | Mol File: | 1050423-87-4.mol |  |
| | 4-Carboxy-2-fluorophenylboronic acid pinacol ester Chemical Properties |
| Melting point | 199-204℃ | | Boiling point | 379.3±32.0 °C(Predicted) | | density | 1.20±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 3.75±0.10(Predicted) | | form | Solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C13H16BFO4/c1-12(2)13(3,4)19-14(18-12)9-6-5-8(11(16)17)7-10(9)15/h5-7H,1-4H3,(H,16,17) | | InChIKey | JSQNZNXVVRPGTD-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(B2OC(C)(C)C(C)(C)O2)C(F)=C1 | | CAS DataBase Reference | 1050423-87-4 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Carboxy-2-fluorophenylboronic acid pinacol ester Usage And Synthesis |
| Uses | 4-Carboxy-2-fluorophenylboronic acid, pinacol ester |
| | 4-Carboxy-2-fluorophenylboronic acid pinacol ester Preparation Products And Raw materials |
|