|
|
| | 4'-(Trans-4-propylcyclohexyl)-2,3-difluoro-4-ethoxy-1,1'-biphenyl Basic information |
| Product Name: | 4'-(Trans-4-propylcyclohexyl)-2,3-difluoro-4-ethoxy-1,1'-biphenyl | | Synonyms: | 3HPYO2;1-ethoxy-2,3-difluoro-4-[4-(4-propylcyclohexyl)phenyl]benzene;4'-(Trans-4-propylcyclohexyl)-2,3-difluoro-4-ethoxy-1,1'-biphenyl;4-ethoxy-2,3-difluoro-4'-(trans-4-propylcyclohexyl)- 1,1'-Biphenyl;3-HBB(2F,3F)-O2;CPY 3O2;4'-(trans-4-Propylcyclohexyl)-2,3-difluoro-4-ethoxy-biphenyl;3F)-O2 | | CAS: | 189750-98-9 | | MF: | C23H28F2O | | MW: | 358.47 | | EINECS: | 685-368-6 | | Product Categories: | | | Mol File: | 189750-98-9.mol |  |
| | 4'-(Trans-4-propylcyclohexyl)-2,3-difluoro-4-ethoxy-1,1'-biphenyl Chemical Properties |
| Melting point | 77.0 to 81.0 °C | | Boiling point | 440.6±45.0 °C(Predicted) | | density | 1.057±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Toluene | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C23H28F2O/c1-3-5-16-6-8-17(9-7-16)18-10-12-19(13-11-18)20-14-15-21(26-4-2)23(25)22(20)24/h10-17H,3-9H2,1-2H3/t16-,17- | | InChIKey | IBFAIOMGVHPWRQ-QAQDUYKDSA-N | | SMILES | C1(C2=CC=C([C@@H]3CC[C@@H](CCC)CC3)C=C2)=CC=C(OCC)C(F)=C1F | | CAS DataBase Reference | 189750-98-9 |
| | 4'-(Trans-4-propylcyclohexyl)-2,3-difluoro-4-ethoxy-1,1'-biphenyl Usage And Synthesis |
| Chemical Properties | white crystal |
| | 4'-(Trans-4-propylcyclohexyl)-2,3-difluoro-4-ethoxy-1,1'-biphenyl Preparation Products And Raw materials |
|