|
|
| | 3,5-bis(3-(9H-carbazol-9-yl)phenyl)pyridine Basic information | | Classification |
| Product Name: | 3,5-bis(3-(9H-carbazol-9-yl)phenyl)pyridine | | Synonyms: | 3,5-bis(3-(9H-carbazol-9-yl)phenyl)pyridine;35DCzPPy;35DCzPPy , 3,5-bis(3-(9H-carbazol-9-yl)phenyl)pyridine;9,9'-(3,5-Pyridinediyldi-3,1-phenylene)bis-9H-carbazole;9H-carbazol-9-yl)phenyl)pyridine;9H-Carbazole, 9,9'-(3,5-pyridinediyldi-3,1-phenylene)bis- | | CAS: | 1013405-25-8 | | MF: | C41H27N3 | | MW: | 561.67 | | EINECS: | | | Product Categories: | OLED | | Mol File: | 1013405-25-8.mol |  |
| | 3,5-bis(3-(9H-carbazol-9-yl)phenyl)pyridine Chemical Properties |
| Melting point | 237 °C | | density | 1.21 | | storage temp. | Store at room temperature | | pka | 4.25±0.23(Predicted) | | InChIKey | VDHOGVHFPFGPIP-UHFFFAOYSA-N | | SMILES | C1=NC=C(C2C=CC=C(N3C4=C(C=CC=C4)C4=C3C=CC=C4)C=2)C=C1C1C=CC=C(N2C3=C(C=CC=C3)C3=C2C=CC=C3)C=1 | | Absorption | λmax307 nm, 317nm (in CH2Cl2) | | color | White powder/crystals |
| | 3,5-bis(3-(9H-carbazol-9-yl)phenyl)pyridine Usage And Synthesis |
| Classification | Carbazole derivatives, Bipolar charge transport layer materials, Phosphorescent host materials, OLEDs, Organic electronics. | | Description | 3,5-bis(3-(carbazol-9-yl)phenyl)pyridine (35DCzPPy) is an electron donor, which has achieved blue-light emitting by the excited state intermolecular charge transfer process.
DOI:10.1109/ICOCN.2019.8934343 |
| | 3,5-bis(3-(9H-carbazol-9-yl)phenyl)pyridine Preparation Products And Raw materials |
|