|
|
| | (-)-Syringaresnol-4-O-β-D-apiofuranosyl-(1→2)-β-D-glucopyranoside Basic information |
| | (-)-Syringaresnol-4-O-β-D-apiofuranosyl-(1→2)-β-D-glucopyranoside Chemical Properties |
| Melting point | 119-121℃ | | Boiling point | 922.7±65.0 °C(Predicted) | | density | 1.54±0.1 g/cm3 (20 ºC 760 Torr) | | storage temp. | 2-8°C | | solubility | DMSO : 250 mg/mL (350.78 mM; Need ultrasonic) | | pka | 9.85±0.40(Predicted) | | form | Powder | | color | White to yellow | | InChIKey | BUBVKRMIMSPLND-NUEFYBFQSA-N | | SMILES | [H][C@]12[C@H](C3=CC(OC)=C(O)C(OC)=C3)OC[C@@]1([H])[C@H](C4=CC(OC)=C(O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O[C@@]6([H])[C@H](O)[C@@](O)(CO)CO6)C(OC)=C4)OC2 |
| Safety Statements | 24/25 | | WGK Germany | WGK 3 | | HS Code | 29389090 | | Storage Class | 11 - Combustible Solids |
| | (-)-Syringaresnol-4-O-β-D-apiofuranosyl-(1→2)-β-D-glucopyranoside Usage And Synthesis |
| Chemical Properties | Off-white crystalline powder, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from the bark of Albizia julibrissin. | | Uses | 4-[(1R,3aS,4R,6aS)-4-(4-Hydroxy-3,5-dimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-2,6-dimethoxyphenyl 2-O-D-Apio-β-D-furanosyl-β-D-glucopyranoside is a lignan glycosides from the bark of Albizzia myriophylla. |
| | (-)-Syringaresnol-4-O-β-D-apiofuranosyl-(1→2)-β-D-glucopyranoside Preparation Products And Raw materials |
|