|
|
| | (S)-Boc-2-amino-4,4,4-trifluoro-butyric acid Basic information |
| Product Name: | (S)-Boc-2-amino-4,4,4-trifluoro-butyric acid | | Synonyms: | (S)-Boc-2-amino-4,4,4-trifluoro-butyric acid;(S)-Boc-2-amino-4,4,4-trifluoro-butyric acid≥ 98% (HPLC);Butanoic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-4,4,4-trifluoro-, (2S)-;(2S)-2-{[(tert-butoxy)carbonyl]amino}-4,4,4-trifluorobutanoic acid;(2S)-4,4,4-Trifluoro-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoicacid;(L)-4,4,4-Trifluoro-α-Homoalanine, N-Boc Protected;(S)-2-tert-Butoxycarbonylamino-4,4,4-trifluoro-butyric acid;(S)-2-((tert-Butoxycarbonyl)amino)-4,4,4-trifluorobutanoic acid | | CAS: | 181128-25-6 | | MF: | C9H14F3NO4 | | MW: | 257.21 | | EINECS: | | | Product Categories: | | | Mol File: | 181128-25-6.mol |  |
| | (S)-Boc-2-amino-4,4,4-trifluoro-butyric acid Chemical Properties |
| Boiling point | 322.8±42.0 °C(Predicted) | | density | 1.280±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 3.34±0.10(Predicted) | | form | powder | | color | White | | Optical Rotation | Consistent with structure | | InChI | InChI=1S/C9H14F3NO4/c1-8(2,3)17-7(16)13-5(6(14)15)4-9(10,11)12/h5H,4H2,1-3H3,(H,13,16)(H,14,15)/t5-/m0/s1 | | InChIKey | UCUKFQMRNHNNQY-YFKPBYRVSA-N | | SMILES | C(O)(=O)[C@@H](NC(OC(C)(C)C)=O)CC(F)(F)F |
| | (S)-Boc-2-amino-4,4,4-trifluoro-butyric acid Usage And Synthesis |
| Chemical Properties | White to off-white powder |
| | (S)-Boc-2-amino-4,4,4-trifluoro-butyric acid Preparation Products And Raw materials |
|