|
|
| | 3,7-Dihydro-3,7-diMethyl-6-[(5-oxohexyl)oxy]-2H-purin-2-one Basic information |
| Product Name: | 3,7-Dihydro-3,7-diMethyl-6-[(5-oxohexyl)oxy]-2H-purin-2-one | | Synonyms: | 3,7-Dihydro-3,7-diMethyl-6-[(5-oxohexyl)oxy]-2H-purin-2-one;3,7-dimethyl-6-(5-oxohexoxy)purin-2-one;Pentoxifylline Impurity G;Pentoxifylline EP impurity G;Pentoxifylline Impurity 7(Pentoxifylline EP Impurity G);2H-Purin-2-one, 3,7-dihydro-3,7-dimethyl-6-[(5-oxohexyl)oxy]-;3,7-dimethyl-6-((5-oxohexyl)oxy)-3,7-dihydro-2H-purin-2-one;Pentoxifylline Impurity 7(Pentoxifylline EP Impurity A) | | CAS: | 93079-86-8 | | MF: | C13H18N4O3 | | MW: | 278.31 | | EINECS: | | | Product Categories: | Heterocycles;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 93079-86-8.mol | ![3,7-Dihydro-3,7-diMethyl-6-[(5-oxohexyl)oxy]-2H-purin-2-one Structure](CAS/GIF/93079-86-8.gif) |
| | 3,7-Dihydro-3,7-diMethyl-6-[(5-oxohexyl)oxy]-2H-purin-2-one Chemical Properties |
| Melting point | 189 - 192°C | | Boiling point | 518.4±56.0 °C(Predicted) | | density | 1.29±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Dichloromethane (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.69±0.20(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C13H18N4O3/c1-9(18)6-4-5-7-20-12-10-11(14-8-16(10)2)17(3)13(19)15-12/h8H,4-7H2,1-3H3 | | InChIKey | AVWIQTQAJMTMIH-UHFFFAOYSA-N | | SMILES | N1(C)C2=C(N(C)C(=O)N=C2OCCCCC(=O)C)N=C1 |
| | 3,7-Dihydro-3,7-diMethyl-6-[(5-oxohexyl)oxy]-2H-purin-2-one Usage And Synthesis |
| Uses | 3,7-Dihydro-3,7-dimethyl-6-[(5-oxohexyl)oxy]-2H-purin-2-one (Pentoxifylline EP Impurity G) is a byproduct of Pentoxifylline synthesis. Pentoxifylline (P276500) impurity. |
| | 3,7-Dihydro-3,7-diMethyl-6-[(5-oxohexyl)oxy]-2H-purin-2-one Preparation Products And Raw materials |
|