| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 6-Methoxysalicylic acid Basic information |
| | 6-Methoxysalicylic acid Chemical Properties |
| Melting point | 134-138 | | Boiling point | 330.4±27.0 °C(Predicted) | | density | 1.351±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 2.98±0.25(Predicted) | | form | Powder | | color | White | | InChI | InChI=1S/C8H8O4/c1-12-6-4-2-3-5(9)7(6)8(10)11/h2-4,9H,1H3,(H,10,11) | | InChIKey | AAUQLHHARJUJEH-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=C(OC)C=CC=C1O | | CAS DataBase Reference | 3147-64-6(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29189900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 6-Methoxysalicylic acid Usage And Synthesis |
| Uses | 6-Methoxysalicylic acid has been used to fabricate a dummy template molecule required for the preparation of dummy molecularly imprinted polymers (DMIPs). These polymers are useful for the simultaneous selective removal and enrichment of ginkgolic acids (GAs) during the processing of Ginkgo biloba leaves. It may be employed as internal standard for the determination of acetylsalicylic acid (aspirin, ASA) and its major metabolite, salicylic acid (SA), in animal plasma by LC/MS/MS. | | Definition | ChEBI: 6-Methoxysalicylic acid is a methoxybenzoic acid. | | General Description | 6-Methoxysalicylic acid has been reported to exhibit significant analgesic effects. |
| | 6-Methoxysalicylic acid Preparation Products And Raw materials |
|