- Amoxicillin Impurity F
-
- $0.00 / 10mg
-
2026-01-23
- CAS:126247-63-0
- Min. Order: 10mg
- Purity: 98%
- Supply Ability: 500mg
|
| | 3-(4-Hydroxyphenyl)-2(1H)-pyrazinone Basic information |
| Product Name: | 3-(4-Hydroxyphenyl)-2(1H)-pyrazinone | | Synonyms: | Amoxicillin impurity 5/Amoxicillin EP Impurity F;Amoxicillin Related Compound F (15 mg) (3-(4-Hydroxyphenyl)pyrazin-2-ol;phenylpyrazinediol);AMoxicillin EP IMpurity F;AMoxicillin Related CoMpound F;3-(4-hydroxyphenyl)pyrazin-2-ol;3-(4-oxocyclohexa-2,5-dien-1-ylidene)-1,4-dihydropyrazin-2-one;Amoxicillin Impurity 6（EP Impurity F） | | CAS: | 126247-63-0 | | MF: | C10H8N2O2 | | MW: | 188.18 | | EINECS: | | | Product Categories: | Aromatics;Heterocycles;Impurities | | Mol File: | 126247-63-0.mol |  |
| | 3-(4-Hydroxyphenyl)-2(1H)-pyrazinone Chemical Properties |
| Melting point | >146°C (dec.) | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Very Slightly, Heated) | | form | Solid | | pka | 8.83±0.30(Predicted) | | color | Pale Brown to Light Brown | | Major Application | pharmaceutical | | InChI | 1S/C10H8N2O2/c13-8-3-1-7(2-4-8)9-10(14)12-6-5-11-9/h1-6,13H,(H,12,14) | | InChIKey | KNKDJXWCPVPHPA-UHFFFAOYSA-N | | SMILES | [nH]1[c](c(ncc1)c2ccc(cc2)O)=O |
| WGK Germany | WGK 3 | | HS Code | 2933997500 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-(4-Hydroxyphenyl)-2(1H)-pyrazinone Usage And Synthesis |
| Uses | A potential impuritiy of the penicillins, ampicillin and amoxicillin, which have not been reported previously.
r upon their degradation. | | Uses | 3-(4-Hydroxyphenyl)-2(1H)-pyrazinone (Amoxicillin EP Impurity F) is a potential impuritiy of the penicillins, ampicillin and amoxicillin, which have not been reported previously. This impurity may be formed during the semi-synthetic preparation of these antibiotics or upon their degradation. |
| | 3-(4-Hydroxyphenyl)-2(1H)-pyrazinone Preparation Products And Raw materials |
|