|
|
| | HIPPURIC ACID SODIUM SALT Basic information |
| Product Name: | HIPPURIC ACID SODIUM SALT | | Synonyms: | n-benzoyl-glycinmonosodiumsalt;N-BENZOYLGLYCINE SODIUM SALT;Glycine,N-benzoyl-,monosodiumsalt;hippuricacid,monosodiumsalt;Glycine, N-benzoyl-,sodium salt (1:1);HIPPURIC ACID SODIUM SALT;BENZOYLAMINOACETIC ACID SODIUM SALT;BENZOYLAMINOACETIC SODIUM SALT | | CAS: | 532-94-5 | | MF: | C9H10NNaO3 | | MW: | 203.17 | | EINECS: | 208-548-4 | | Product Categories: | | | Mol File: | 532-94-5.mol |  |
| | HIPPURIC ACID SODIUM SALT Chemical Properties |
| Melting point | 240～244℃ | | storage temp. | Sealed in dry,Room Temperature | | solubility | H2O: 0.5 M at 20 °C, clear, colorless | | form | Solid | | color | White powder | | Water Solubility | Soluble in water. | | BRN | 3638470 | | Major Application | detection | | InChI | 1S/C9H9NO3.Na.H2O/c11-8(12)6-10-9(13)7-4-2-1-3-5-7;;/h1-5H,6H2,(H,10,13)(H,11,12);;1H2/q;+1;/p-1 | | InChIKey | IOZRWVOSUXHESF-UHFFFAOYSA-M | | SMILES | O.[Na+].[O-]C(=O)CNC(=O)c1ccccc1 | | CAS DataBase Reference | 532-94-5(CAS DataBase Reference) | | EPA Substance Registry System | Glycine, N-benzoyl-, monosodium salt (532-94-5) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 24/25-36/37-26-22 | | WGK Germany | 3 | | RTECS | MR8170000 | | TSCA | TSCA listed | | HS Code | 2924.29.9500 | | Storage Class | 11 - Combustible Solids |
| | HIPPURIC ACID SODIUM SALT Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | Hippuric Acid Sodium Salt can be used for agrobacterium-mediated rice genetic transformation method. | | Biochem/physiol Actions | Hippuric acid is a low molecular weight phenolic carboxylic acid urinary metabolite that may be a useful urinary biomarker for certain cancers such as gastric cancer and oxidative stress. | | in vivo | Sodium hippurate, 98% (Hippuric acid, 100 mg/kg; i.p.; five times per week; 10 weeks) promotes renal fibrosis and dysfunction in 5/6 nephrectomized rats[4].
Sodium hippurate, 98% (Hippuric acid, 10 mg/kg; p.o.; daily; 4 weeks) alleviates hyperuricemia in mice by promoting intestinal urate excretion via enhancing ABCG2-mediated transport[5].
Sodium hippurate, 98% (Hippuric acid, 50-150 mg/kg; p.o.; once daily; 7 days) alleviates DSS-induced colitis in male C57BL/6J mice, as shown by reduced clinical activity, improved intestinal barrier integrity, and modulated gut microbiota[6].
| Animal Model: | Male Sprague Dawley rats (7-week-old, weight not specified); 5/6 nephrectomy model[4] | | Dosage: | 100 mg/kg | | Administration: | Intraperitoneal injection, five times per week, for 10 weeks | | Result: | Significantly increased levels of serum creatinine (SCr), blood urea nitrogen (BUN), and HA.
Showed increased tubulointerstitial fibrosis and glomerulosclerosis, with larger COL1A1-, VIM-, and ACTA2-positive areas.
Revealed lower NRF2 levels.
Decreased activities of SOD, CAT, and GSH- Px.
Increased MDA levels in the kidneys, indicating redox imbalance.
|
| | IC 50 | MMP9; Microbial Metabolite; Human Endogenous Metabolite |
| | HIPPURIC ACID SODIUM SALT Preparation Products And Raw materials |
|