|
|
| | Maleimide-PEG4-NHS Ester Basic information |
| Product Name: | Maleimide-PEG4-NHS Ester | | Synonyms: | alpha-MaleiMidopropionyl-oMega-succiniMidyl-4(ethylene glycol);N-[15-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-15-oxo-3,6,9,12-tetraoxapentadec-1-yl]-2,5-dihydro-2,5-dioxo-1H-pyrrole-1-propanamide;O-[N-(3-MaleiMidopropionyl)aMinoethyl]-O′-[3-(N-succiniMidyloxy)-3-oxopropyl]triethylene glycol;O-[N-(3-Maleimidopropionyl)aminoethyl]-O'-[3-(N-succinimidyloxy)-3-oxopropyl]triethylene glycol >=90% (NMR);Mal-amido-PEG4-NHS;MAL-DPEG4-NHS Ester;3-(2-Maleimidoethylcarbamoyl)-peg4-propionic acid N-hydroxysuccinimide ester;Maleimide-NH-PEG4-CH2CH2COONHS Ester | | CAS: | 756525-99-2 | | MF: | C22H31N3O11 | | MW: | 513.49 | | EINECS: | 201-258-5 | | Product Categories: | peg | | Mol File: | 756525-99-2.mol |  |
| | Maleimide-PEG4-NHS Ester Chemical Properties |
| density | 1.36±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in DMSO | | form | Solid | | pka | 15.01±0.46(Predicted) | | color | White to off-white | | InChI | InChI=1S/C22H31N3O11/c26-17(5-8-24-18(27)1-2-19(24)28)23-7-10-33-12-14-35-16-15-34-13-11-32-9-6-22(31)36-25-20(29)3-4-21(25)30/h1-2H,3-16H2,(H,23,26) | | InChIKey | XSRYGQJQNPJNKZ-UHFFFAOYSA-N | | SMILES | C(ON1C(=O)CCC1=O)(=O)CCOCCOCCOCCOCCNC(=O)CCN1C(=O)C=CC1=O |
| WGK Germany | 3 | | HS Code | 2928009090 | | Storage Class | 10 - Combustible liquids |
| | Maleimide-PEG4-NHS Ester Usage And Synthesis |
| Description | Mal-amido-PEG4-NHS is a PEG linker containing a maleimide group and an NHS ester. The hydrophilic PEG spacer increases solubility in aqueous media. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. The maleimide group will react with a thiol group to form a covalent bond, enabling the connection of biomolecule with a thiol. | | Uses | Maleimide-PEG4-NHS (CAS# 756525-99-2) is a cross-linking compound used in the lysosomal acid-triggered release of anticancer drugs. | | reaction suitability | reagent type: cross-linking reagent | | IC 50 | PEGs; Alkyl/ether |
| | Maleimide-PEG4-NHS Ester Preparation Products And Raw materials |
|