- AMIMNTF2
-
- $5.00
-
2019-08-06
- CAS:655249-87-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 1ton
|
| | AMIMNTF2 Basic information |
| Product Name: | AMIMNTF2 | | Synonyms: | AMIMNTF2;1-Allyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide
;1-Allyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide >=98.5% (HPLC);1-Allyl-3-methylimidazolium Bis(trifluoromethanesulfonyl)imide;bis(trifluoromethylsulfonyl)azanide:1-methyl-3-prop-2-enylimidazol-1-ium;1-allyl-3-imethylimidazolium bis[(trifluoromethyl)sulfonyl]imide;3-allyl-1-methyl-1H-imidazol-3-ium bis((trifluoromethyl)sulfonyl)imide;SKL1489 | | CAS: | 655249-87-9 | | MF: | C9H11F6N3O4S2 | | MW: | 403.31 | | EINECS: | 200-144-5 | | Product Categories: | | | Mol File: | 655249-87-9.mol |  |
| | AMIMNTF2 Chemical Properties |
| density | 1.494 (29°C) | | refractive index | 1.4320 to 1.4360 | | storage temp. | Inert atmosphere,Room Temperature | | form | clear liquid | | color | Colorless to Light orange to Yellow | | InChI | InChI=1S/C7H11N2.C2F6NO4S2/c1-3-4-9-6-5-8(2)7-9;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3,5-7H,1,4H2,2H3;/q+1;-1 | | InChIKey | DHMWATGUEVQTIY-UHFFFAOYSA-N | | SMILES | C(N1C=C[N+](C)=C1)C=C.S(=O)(=O)(C(F)(F)F)[N-]S(=O)(=O)C(F)(F)F | | ECW | 4.8 V |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2935.90.7500 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 |
| | AMIMNTF2 Usage And Synthesis |
| Conductivity | 8.871 mS/cm (30 °C) | | Uses | 1-Allyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide can be used to prepare AMIMTFSI-propylene carbonate based electrolyte, with potential application in lithium-ion batteries. It also finds application in alkanes/alkenes separation process. AMIMTFSI can be used as a surface protector to develop luminescent silicon nanoparticles. | | General Description | 1-Allyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide is an ionic liquid that can be prepared by reacting 1-allyl-3-methylimidazolium chloride and lithium bis(trifluoromethylsulfonyl)imide under microwave conditions. |
| | AMIMNTF2 Preparation Products And Raw materials |
|