| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | 4-Chloro-2-methyl-1,8-naphthyridine Basic information |
| | 4-Chloro-2-methyl-1,8-naphthyridine Chemical Properties |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | solid | | color | Brown | | InChI | InChI=1S/C9H7ClN2/c1-6-5-8(10)7-3-2-4-11-9(7)12-6/h2-5H,1H3 | | InChIKey | ANAARUOUJJHNRR-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=CN=2)C(Cl)=CC=1C |
| Risk Statements | 36 | | Safety Statements | 26 | | HazardClass | IRRITANT | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 4-Chloro-2-methyl-1,8-naphthyridine Usage And Synthesis |
| | 4-Chloro-2-methyl-1,8-naphthyridine Preparation Products And Raw materials |
|