| Company Name: |
Cochemical Ltd. |
| Tel: |
029-86115547 17791676824 |
| Email: |
sales@cochemical.com |
1-Piperidinecarboxylic acid, 3,3-difluoro-4-hydroxy-, 1,1-diMethylethyl ester manufacturers
|
| | 1-Piperidinecarboxylic acid, 3,3-difluoro-4-hydroxy-, 1,1-diMethylethyl ester Basic information |
| Product Name: | 1-Piperidinecarboxylic acid, 3,3-difluoro-4-hydroxy-, 1,1-diMethylethyl ester | | Synonyms: | 1-Piperidinecarboxylic acid, 3,3-difluoro-4-hydroxy-, 1,1-diMethylethyl ester;1-Boc-3,3-difluoro-4-hydr...;1-Boc-3,3-difluoro-4-hydroxypiperidine;3,3-Difluoro-4-hydroxy-1-piperidinecarboxylic acid 1,1-dimethylethyl ester;tert-butyl (R)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate;1-Boc-3,3-difluoropiperidin-4-ol;1-Piperidinecarboxylic acid, 3,3-difluoro-4-hydroxy-, 1,1-diMethylethyl este;tert-butyl 3,3-difluoro-4-hydroxypiperidine-1-carboxylate | | CAS: | 1209780-71-1 | | MF: | C10H17F2NO3 | | MW: | 237.24 | | EINECS: | | | Product Categories: | | | Mol File: | 1209780-71-1.mol |  |
| | 1-Piperidinecarboxylic acid, 3,3-difluoro-4-hydroxy-, 1,1-diMethylethyl ester Chemical Properties |
| Boiling point | 296.2±40.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 12.50±0.40(Predicted) | | form | solid | | color | White to off-white | | InChI | InChI=1S/C10H17F2NO3/c1-9(2,3)16-8(15)13-5-4-7(14)10(11,12)6-13/h7,14H,4-6H2,1-3H3 | | InChIKey | GISYXRBCSOIMTM-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(O)C(F)(F)C1 |
| | 1-Piperidinecarboxylic acid, 3,3-difluoro-4-hydroxy-, 1,1-diMethylethyl ester Usage And Synthesis |
| | 1-Piperidinecarboxylic acid, 3,3-difluoro-4-hydroxy-, 1,1-diMethylethyl ester Preparation Products And Raw materials |
|