| Company Name: |
Wuxi AppTec |
| Tel: |
022-59987777 13552403979 |
| Email: |
jia_guoqiang@wuxiapptec.com |
|
| | 2-(2-Methoxyphenyl)-2-methylpropionic acid Basic information |
| | 2-(2-Methoxyphenyl)-2-methylpropionic acid Chemical Properties |
| Melting point | 128 °C | | Boiling point | 324.6±25.0 °C(Predicted) | | density | 1.111±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | form | solid | | pka | 4.26±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C11H14O3/c1-11(2,10(12)13)8-6-4-5-7-9(8)14-3/h4-7H,1-3H3,(H,12,13) | | InChIKey | IZBKHGFHJGMWGV-UHFFFAOYSA-N | | SMILES | O=C(O)C(C)(C)C1=CC=CC=C1OC |
| WGK Germany | WGK 3 | | HS Code | 2918999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 2-(2-Methoxyphenyl)-2-methylpropionic acid Usage And Synthesis |
| | 2-(2-Methoxyphenyl)-2-methylpropionic acid Preparation Products And Raw materials |
|