|
|
| | 1-(Bromomethyl)-2-fluoro-3-(trifluoromethoxy)benzene Basic information |
| | 1-(Bromomethyl)-2-fluoro-3-(trifluoromethoxy)benzene Chemical Properties |
| form | liquid | | color | Clear, colourless | | InChI | 1S/C8H5BrF4O/c9-4-5-2-1-3-6(7(5)10)14-8(11,12)13/h1-3H,4H2 | | InChIKey | YCLRETLTIMECAI-UHFFFAOYSA-N | | SMILES | FC1=C(C=CC=C1OC(F)(F)F)CBr |
| HS Code | 2902900000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 1-(Bromomethyl)-2-fluoro-3-(trifluoromethoxy)benzene Usage And Synthesis |
| | 1-(Bromomethyl)-2-fluoro-3-(trifluoromethoxy)benzene Preparation Products And Raw materials |
|