|
|
| | 2-(4-(2-hydroxyethyl)phenyl)-2-Methylpropanoic acid Basic information | | Uses |
| Product Name: | 2-(4-(2-hydroxyethyl)phenyl)-2-Methylpropanoic acid | | Synonyms: | 2-(4-(2-hydroxyethyl)phenyl)-2-Methylpropanoic acid;Benzeneacetic acid, 4-(2-hydroxyethyl)-α,α-dimethyl-;4-(2-Hydroxyethyl)-α,α-dimethylbenzeneacetic acid;Pilastine impurity 40;4-(2-Hydroxyethyl)-alpha,alpha-dimethylbenzeneacetic acid | | CAS: | 552301-45-8 | | MF: | C12H16O3 | | MW: | 208.25 | | EINECS: | | | Product Categories: | | | Mol File: | 552301-45-8.mol |  |
| | 2-(4-(2-hydroxyethyl)phenyl)-2-Methylpropanoic acid Chemical Properties |
| Boiling point | 362.2±22.0 °C(Predicted) | | density | 1.150±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 4.42±0.10(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C12H16O3/c1-12(2,11(14)15)10-5-3-9(4-6-10)7-8-13/h3-6,13H,7-8H2,1-2H3,(H,14,15) | | InChIKey | CHSAZBMOBSHGFV-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(C1=CC=C(CCO)C=C1)(C)C |
| | 2-(4-(2-hydroxyethyl)phenyl)-2-Methylpropanoic acid Usage And Synthesis |
| Uses | 2-(4-(2-hydroxyethyl)phenyl)-2-methylpropionic acid is a carboxylic acid derivative that can be used as a pharmaceutical intermediate. |
| | 2-(4-(2-hydroxyethyl)phenyl)-2-Methylpropanoic acid Preparation Products And Raw materials |
|