| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
|
| | 3-Methyl-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)isoxazole Basic information |
| Product Name: | 3-Methyl-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)isoxazole | | Synonyms: | 3-Methyl-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)isoxazole;3-Methyl-isoxazole-5-boronic acid pinacol ester;3-Methyl-isoxazole-5-boronic acid picol ester;3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole;3-methyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole;Isoxazole, 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- | | CAS: | 1346808-44-3 | | MF: | C10H16BNO3 | | MW: | 209.05 | | EINECS: | | | Product Categories: | | | Mol File: | 1346808-44-3.mol |  |
| | 3-Methyl-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)isoxazole Chemical Properties |
| Boiling point | 311.5±30.0 °C(Predicted) | | density | 1.06±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | pka | -1.38±0.50(Predicted) | | InChI | InChI=1S/C10H16BNO3/c1-7-6-8(13-12-7)11-14-9(2,3)10(4,5)15-11/h6H,1-5H3 | | InChIKey | IQNJZSNKCNUQII-UHFFFAOYSA-N | | SMILES | O1C(B2OC(C)(C)C(C)(C)O2)=CC(C)=N1 |
| | 3-Methyl-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)isoxazole Usage And Synthesis |
| | 3-Methyl-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)isoxazole Preparation Products And Raw materials |
|