| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | (1R,4S)-Methyl 4-aMinocyclopent-2-enecarboxyla Basic information |
| Product Name: | (1R,4S)-Methyl 4-aMinocyclopent-2-enecarboxyla | | Synonyms: | (1R,4S)-Methyl 4-aMinocyclopent-2-enecarboxyla;(1S,4R)-4-AMino-cyclopent-2-enecarboxylic-acid Methyl ester L-tartaric acid;(1S,4R)-Methyl-4-aMinocyclopent-2-enecarboxylate L-tartaric acid;(1S,4R)-4-AMino-2-cyclopentene-1-carboxylic Acid Methyl Ester (2R,3R)-2,3-Dihydroxybutanedioate;(1S,4R)-4-Amino-2-cyclopentene-1-carboxylic Acid Methyl Ester L-Tartrate;(1S,4R)-Methyl 4-aminocyclopent-2-enecarboxylate (2R,3R)-2,3-dihydroxysuccinate;(2R,3R)-2,3-dihydroxybutanedioic acid,methyl (1S,4R)-4-aminocyclopent-2-ene-1-carboxylate;Peramivir Intermediater | | CAS: | 419563-22-7 | | MF: | C11H17NO8 | | MW: | 291.26 | | EINECS: | 1312995-182-4 | | Product Categories: | | | Mol File: | 419563-22-7.mol |  |
| | (1R,4S)-Methyl 4-aMinocyclopent-2-enecarboxyla Chemical Properties |
| Melting point | 166-168°C | | storage temp. | 2-8°C | | solubility | DMSO (Sparingly), Water | | form | Solid | | color | Off-White to Light Beige | | InChI | InChI=1/C7H11NO2.C4H6O6/c1-10-7(9)5-2-3-6(8)4-5;5-1(3(7)8)2(6)4(9)10/h2-3,5-6H,4,8H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t5-,6+;1-,2-/s3 | | InChIKey | XSEHIOOHMZAFCV-CEBBRUCFNA-N | | SMILES | [C@H](O)(C(=O)O)[C@@H](O)C(=O)O.C([C@@H]1C=C[C@H](N)C1)(=O)OC |&1:0,5,11,14,r| |
| | (1R,4S)-Methyl 4-aMinocyclopent-2-enecarboxyla Usage And Synthesis |
| Uses | (1S,4R)-4-Amino-2-cyclopentene-1-carboxylic Acid Methyl Ester is an intermediate used in the synthesis of peramivir (P285500), a neuraminidase inhibitor developed as an antiviral agent for the treatment of influenza. |
| | (1R,4S)-Methyl 4-aMinocyclopent-2-enecarboxyla Preparation Products And Raw materials |
|