1-PYRIMIDIN-2-YL-PIPERIDIN-4-OL manufacturers
|
| | 1-PYRIMIDIN-2-YL-PIPERIDIN-4-OL Basic information |
| Product Name: | 1-PYRIMIDIN-2-YL-PIPERIDIN-4-OL | | Synonyms: | 1-PYRIMIDIN-2-YL-PIPERIDIN-4-OL;1-(2-Pyrimidinyl)-4-piperidinol;N-(2-Pyrimidinyl)-4-hydroxypiperidine;4-Piperidinol, 1-(2-pyrimidinyl)-;1-PYRIMIDIN-2-YL-PIPERIDIN-4-OL ISO 9001：2015 REACH;1,3-Benzodioxole-5-carboxaldehyde,9-methoxy-;2-Naphthalenesulfonylchloride,5,6,7,8-tetrahydro-5,5,8,13-tetramethyl-;4-Hydroxy-1-(2-pyrimidyl)piperidine | | CAS: | 893755-98-1 | | MF: | C9H13N3O | | MW: | 179.22 | | EINECS: | | | Product Categories: | | | Mol File: | 893755-98-1.mol |  |
| | 1-PYRIMIDIN-2-YL-PIPERIDIN-4-OL Chemical Properties |
| Boiling point | 365.5±52.0 °C(Predicted) | | density | 1.234±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 14.56±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C9H13N3O/c13-8-2-6-12(7-3-8)9-10-4-1-5-11-9/h1,4-5,8,13H,2-3,6-7H2 | | InChIKey | ZATIGSFNFLXZAS-UHFFFAOYSA-N | | SMILES | N1(C2=NC=CC=N2)CCC(O)CC1 |
| | 1-PYRIMIDIN-2-YL-PIPERIDIN-4-OL Usage And Synthesis |
| Synthesis | Step 1: Synthesis of 1-(2-pyrimidinyl)-4-piperidinol (180)
4-Hydroxypiperidine (1.5 g, 14.7 mmol), 2-chloropyrimidine (1.5 g, 13.4 mmol) and diisopropylethylamine (6 mL, 33.5 mmol) were dissolved in 50 mL of acetonitrile. The reaction mixture was heated and stirred at 80 °C for 18 hours. After completion of the reaction, the mixture was concentrated to dryness under reduced pressure. The crude product was purified by fast column chromatography using a 0-60% ethyl acetate/hexane gradient elution to afford 2.1 g (81% yield) of target compound 180 as a white solid.
1H NMR (400 MHz, CDCl3): δ 8.28 (d, J = 4.6 Hz, 2H), 6.49 (t, J = 4.8 Hz, 1H), 4.49-4.33 (m, 2H), 4.01-3.88 (m, 1H), 3.37-3.21 (m, 2H), 2.02-1.90 (m, 2H), 1.60- 1.45 (m, 2H); LCMS (ESI): m/z 180 [M + H]+. | | References | [1] Patent: WO2008/8895, 2008, A1. Location in patent: Page/Page column 155; 156
[2] Journal of Medicinal Chemistry, 2012, vol. 55, # 24, p. 10972 - 10994 |
| | 1-PYRIMIDIN-2-YL-PIPERIDIN-4-OL Preparation Products And Raw materials |
|