|
|
| | 2,5-DICHLOROBENZYL ALCOHOL Basic information |
| Product Name: | 2,5-DICHLOROBENZYL ALCOHOL | | Synonyms: | 2,5-DICHLOROBENZYL ALCOHOL;RARECHEM AL BD 0427;Benzenemethanol, 2,5-dichloro-;2,5-dichlorobenzylic alcohol;(2,5-Dichloro-phenyl)-methanol;2,5-Dichlorobenzylalcohol,99%;2,5-DICHLOROBENZYL ALCOHOL 99%;2,4-Dichlorobenzyl alcohol impurity A | | CAS: | 34145-05-6 | | MF: | C7H6Cl2O | | MW: | 177.02 | | EINECS: | 251-850-6 | | Product Categories: | Benzhydrols, Benzyl & Special Alcohols;Alcohols;C7 to C8;Oxygen Compounds | | Mol File: | 34145-05-6.mol |  |
| | 2,5-DICHLOROBENZYL ALCOHOL Chemical Properties |
| Melting point | 79-80 °C (lit.) | | Boiling point | 266℃ | | density | 1.392 | | refractive index | 1.5570 (estimate) | | Fp | 114℃ | | storage temp. | 2-8°C | | pka | 13.69±0.10(Predicted) | | form | powder | | Appearance | Off-white to light yellow Solid | | BRN | 3240770 | | InChI | InChI=1S/C7H6Cl2O/c8-6-1-2-7(9)5(3-6)4-10/h1-3,10H,4H2 | | InChIKey | LCEIGNVIDJNUGF-UHFFFAOYSA-N | | SMILES | C1C(CO)=C(Cl)C=CC=1Cl | | CAS DataBase Reference | 34145-05-6(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 2906290090 | | Storage Class | 11 - Combustible Solids |
| | 2,5-DICHLOROBENZYL ALCOHOL Usage And Synthesis |
| Chemical Properties | WHITE FINE CRYSTALLINE POWDER | | Uses | 2,4-Dichlorobenzyl alcohol impurity A EP Reference standard, intended for use in laboratory tests only as specifically prescribed in the European Pharmacopoeia. | | General Description | 2,5-Dichlorobenzyl alcohol participates in [Ru(acac)2(CH3CN)2]PF6 (acac = acetylacetone) catalyzed oxidation of alcohols to aldehydes or ketones using H5IO6 as oxidant. |
| | 2,5-DICHLOROBENZYL ALCOHOL Preparation Products And Raw materials |
|