|
|
| | 1,2-Bis(trimethoxysilyl)ethane Basic information |
| | 1,2-Bis(trimethoxysilyl)ethane Chemical Properties |
| Melting point | <0°C | | Boiling point | 103-104 °C5 mm Hg(lit.) | | density | 1.073 g/mL at 25 °C(lit.) | | vapor pressure | 1.2Pa at 20℃ | | refractive index | n20/D 1.409(lit.) | | Fp | 228 °F | | form | Liquid | | Specific Gravity | 1.09 | | color | Colorless | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | InChI=1S/C8H22O6Si2/c1-9-15(10-2,11-3)7-8-16(12-4,13-5)14-6/h7-8H2,1-6H3 | | InChIKey | JCGDCINCKDQXDX-UHFFFAOYSA-N | | SMILES | CO[Si](OC)(OC)CC[Si](OC)(OC)OC | | LogP | -1.68 at 25℃ | | CAS DataBase Reference | 18406-41-2(CAS DataBase Reference) | | EPA Substance Registry System | 2,7-Dioxa-3,6-disilaoctane, 3,3,6,6-tetramethoxy- (18406-41-2) |
| Hazard Codes | T+ | | Risk Statements | 26 | | Safety Statements | 23-36/37-45 | | RIDADR | UN 3382 6.1/PG 1 | | WGK Germany | 3 | | RTECS | JG7873000 | | TSCA | TSCA listed | | HazardClass | 6.1 | | HS Code | 29319090 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Inhalation |
| | 1,2-Bis(trimethoxysilyl)ethane Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | 3,3,6,6-Tetramethoxy-2,7-dioxa-3,6-disilaoctane is useful in the preparation of functionalized periodic mesoporous organosilicas for selective adsorption of proteins. | | Flammability and Explosibility | Not classified |
| | 1,2-Bis(trimethoxysilyl)ethane Preparation Products And Raw materials |
|