- 3-Methoxy-2-nitropyridine
-
- $5.00 / 1KG
-
2025-09-25
- CAS:20265-37-6
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: g-kg-tons, free sample is available
|
| | 3-Methoxy-2-nitropyridine Basic information |
| | 3-Methoxy-2-nitropyridine Chemical Properties |
| Melting point | 73-76 °C (lit.) | | Boiling point | 311.8±22.0 °C(Predicted) | | density | 1.300±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | pka | -6.34±0.10(Predicted) | | color | White to Yellow to Green | | InChI | InChI=1S/C6H6N2O3/c1-11-5-3-2-4-7-6(5)8(9)10/h2-4H,1H3 | | InChIKey | QRCUQLANPHYVEH-UHFFFAOYSA-N | | SMILES | C1([N+]([O-])=O)=NC=CC=C1OC | | CAS DataBase Reference | 20265-37-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Methoxy-2-nitropyridine Usage And Synthesis |
| Chemical Properties | White to yellow solid |
| | 3-Methoxy-2-nitropyridine Preparation Products And Raw materials |
|