|
|
| | N,N-diMethyl-2-phenylethylaMine hydrochloride (USAF EL-79) Basic information |
| Product Name: | N,N-diMethyl-2-phenylethylaMine hydrochloride (USAF EL-79) | | Synonyms: | N,N-DiMethyl-2-phenylethanaMine hydrochloride;AF 2975;N,N-Dimethylphenethylamine hydrochloride;N,N-Dimethylphenylethylamine hydrochloride;N,N-DiMethylbenzeneethanaMine Hydrochloride;N,N-diMethyl-2-phenylethylaMine hydrochloride;Benzeneethanamine,N,N-dimethyl-, hydrochloride (1:1);N,N-diMethyl-2-phenylethylaMine hydrochloride (USAF EL-79) | | CAS: | 10275-21-5 | | MF: | C10H16ClN | | MW: | 185.69374 | | EINECS: | 1592732-453-0 | | Product Categories: | | | Mol File: | 10275-21-5.mol |  |
| | N,N-diMethyl-2-phenylethylaMine hydrochloride (USAF EL-79) Chemical Properties |
| Melting point | 200-201.5℃ | | storage temp. | Room Temperature, under inert atmosphere | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Pale Beige | | InChI | InChI=1S/C10H15N.ClH/c1-11(2)9-8-10-6-4-3-5-7-10;/h3-7H,8-9H2,1-2H3;1H | | InChIKey | OVBRYLBVLSAOAS-UHFFFAOYSA-N | | SMILES | N(C)(C)CCC1=CC=CC=C1.[H]Cl |
| | N,N-diMethyl-2-phenylethylaMine hydrochloride (USAF EL-79) Usage And Synthesis |
| Description | N,N-Dimethylphenethylamine (hydrochloride) (Item No. 29754) is an analytical reference standard categorized as a phenethylamine. This product is intended for research and forensic applications. | | Uses | N,N-Dimethylbenzeneethanamine is used in the synthesis of squalene synthase inhibitors. |
| | N,N-diMethyl-2-phenylethylaMine hydrochloride (USAF EL-79) Preparation Products And Raw materials |
|