|
|
| | cis-tert-butyl 3-hydroxycyclobutanecarboxylate Basic information |
| Product Name: | cis-tert-butyl 3-hydroxycyclobutanecarboxylate | | Synonyms: | cis-tert-butyl 3-hydroxycyclobutanecarboxylate;(1s,3s)-tert-butyl 3-hydroxycyclobutanecarboxylate;Cyclobutanecarboxylic acid, 3-hydroxy-, 1,1-dimethylethyl ester, cis-;tert-Butyl cis-3-hydroxycyclobutane-1-carboxylate;tert-butyl (1s,3s)-3-hydroxycyclobutane-1-carboxylate, cis;tert-butyl cis-3-hydroxycyclobutanecarboxylate;cis-3-hydroxyclobutanemacetic acidtertbutyl ester;tert-butyl (1s,3s)-3-hydroxycyclobutane-1-carboxylate | | CAS: | 939768-64-6 | | MF: | C9H16O3 | | MW: | 172.22 | | EINECS: | | | Product Categories: | | | Mol File: | 939768-64-6.mol |  |
| | cis-tert-butyl 3-hydroxycyclobutanecarboxylate Chemical Properties |
| Boiling point | 233.532±33.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.110±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Store at room temperature | | pka | 14.731±0.40(predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C9H16O3/c1-9(2,3)12-8(11)6-4-7(10)5-6/h6-7,10H,4-5H2,1-3H3/t6-,7+ | | InChIKey | TYVLAZGEMLWPQS-KNVOCYPGSA-N | | SMILES | [C@@H]1(C(OC(C)(C)C)=O)C[C@H](O)C1 |
| | cis-tert-butyl 3-hydroxycyclobutanecarboxylate Usage And Synthesis |
| | cis-tert-butyl 3-hydroxycyclobutanecarboxylate Preparation Products And Raw materials |
|