|
|
| | Methyl 2-aMino-4-chloro-5-fluorobenzoate Basic information |
| Product Name: | Methyl 2-aMino-4-chloro-5-fluorobenzoate | | Synonyms: | Methyl 2-aMino-4-chloro-5-fluorobenzoate;2-Amino-4-chloro-5-fluoro-benzoic acid methyl ester;BENZOIC ACID, 2-AMINO-4-CHLORO-5-FLUORO-, METHYL ESTER;Methyl 4-chloro-5-fluoroanthranilate | | CAS: | 104901-79-3 | | MF: | C8H7ClFNO2 | | MW: | 203.6 | | EINECS: | | | Product Categories: | | | Mol File: | 104901-79-3.mol |  |
| | Methyl 2-aMino-4-chloro-5-fluorobenzoate Chemical Properties |
| Boiling point | 302.5±42.0 °C(Predicted) | | density | 1.396±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 1.22±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H7ClFNO2/c1-13-8(12)4-2-6(10)5(9)3-7(4)11/h2-3H,11H2,1H3 | | InChIKey | GLUDXCLLUWRJRA-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(F)=C(Cl)C=C1N |
| | Methyl 2-aMino-4-chloro-5-fluorobenzoate Usage And Synthesis |
| | Methyl 2-aMino-4-chloro-5-fluorobenzoate Preparation Products And Raw materials |
|