| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
| Company Name: |
TCI AMERICA |
| Tel: |
800-4238616 |
| Email: |
sales@tciamerica.com |
|
| | 9H-Carbazole, 3-(3,5-dibroMophenyl)-9-phenyl- Basic information |
| | 9H-Carbazole, 3-(3,5-dibroMophenyl)-9-phenyl- Chemical Properties |
| Melting point | 167.0 to 171.0 °C | | Boiling point | 576.3±48.0 °C(Predicted) | | density | 1.52 | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C24H15Br2N/c25-18-12-17(13-19(26)15-18)16-10-11-24-22(14-16)21-8-4-5-9-23(21)27(24)20-6-2-1-3-7-20/h1-15H | | InChIKey | GXVXADLFVMCWNC-UHFFFAOYSA-N | | SMILES | N1(C2=CC=CC=C2)C2=C(C=CC=C2)C2=C1C=CC(C1=CC(Br)=CC(Br)=C1)=C2 |
| | 9H-Carbazole, 3-(3,5-dibroMophenyl)-9-phenyl- Usage And Synthesis |
| | 9H-Carbazole, 3-(3,5-dibroMophenyl)-9-phenyl- Preparation Products And Raw materials |
|